Synthesis and Crystal Structure of Cd(2)(picOH)(4)Cl(2)(H(2)O)(2)

The title complex, Cd(2)(picOH)(4)Cl(2)(H(2)O)(2), was synthesized and characterized by elemental analysis, IR and X-Ray diffraction analysis. Crystallography studies showthat the Cd ion is octahedrally coordinated to two chlorine atoms, one water molecule and N and O atoms in one picOH- ligand and one O atom in the other picOH- ligand.Crystal structures of complexe show a weak bonding interaction between the metal and the hydroxyl oxygen groups.